![[5-chloro-2-(cyclopropylmethylamino)phenyl]-phenylmethanone (CAS: 2897-00-9) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0706810.png "[5-chloro-2-(cyclopropylmethylamino)phenyl]-phenylmethanone chemical structure")
[5-chloro-2-(cyclopropylmethylamino)phenyl]-phenylmethanone
Catalog No: FT-0706810
CAS No: 2897-00-9
- Chemical Name: [5-chloro-2-(cyclopropylmethylamino)phenyl]-phenylmethanone
- Molecular Formula: C17H16ClNO
- Molecular Weight: 285.8
- InChI Key: WCRKZICZCPHVAB-UHFFFAOYSA-N
- InChI: InChI=1S/C17H16ClNO/c18-14-8-9-16(19-11-12-6-7-12)15(10-14)17(20)13-4-2-1-3-5-13/h1-5,8-10,12,19H,6-7,11H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 469.6ºC at 760 mmHg |
|---|---|
| CAS: | 2897-00-9 |
| MF: | C17H16ClNO |
| Density: | 1.252 |
| Melting_Point: | 79-80ºC |
| Product_Name: | [5-chloro-2-(cyclopropylmethylamino)phenyl]-phenylmethanone |
| Flash_Point: | N/A |
| FW: | 285.76800 |
| Density: | 1.252 |
|---|---|
| MF: | C17H16ClNO |
| LogP: | 4.46590 |
| Melting_Point: | 79-80ºC |
| Exact_Mass: | 285.09200 |
| Bolling_Point: | 469.6ºC at 760 mmHg |
| Vapor_Pressure: | 5.42E-09mmHg at 25°C |
| FW: | 285.76800 |
| Refractive_Index: | 1.641 |
| PSA: | 29.10000 |
| HS_Code: | 2922399090 |
|---|---|
| RIDADR: | NONH for all modes of transport |
